About (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol
(2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol (PubChem CID 5462982) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol.
Molecular Properties
| Compound Name | (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol |
| PubChem CID | 5462982 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol |
| SMILES | C=CC(/C=C(\C)CO)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-5-10(8(2)3)6-9(4)7-11/h5-6,10-11H,1-2,7H2,3-4H3/b9-6+ |
| InChIKey | NHJXCMQPMLBAMK-RMKNXTFCSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol?
The IUPAC name of (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol (CID 5462982) is (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol.
What is the SMILES notation for (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol?
The canonical SMILES for (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol is C=CC(/C=C(\C)CO)C(=C)C.
What is the InChIKey of (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol?
The InChIKey is NHJXCMQPMLBAMK-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H16O/c1-5-10(8(2)3)6-9(4)7-11/h5-6,10-11H,1-2,7H2,3-4H3/b9-6+.
What are the key properties of (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol?
(2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol has a molecular weight of 152.24 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-ethenyl-2,5-dimethylhexa-2,5-dien-1-ol is sourced from PubChem (CID 5462982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).