About trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane
trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane (PubChem CID 5463026) has the molecular formula C10H22Si2
and a molecular weight of 198.46 g/mol. Its IUPAC name is trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane |
| PubChem CID | 5463026 |
| Molecular Formula | C10H22Si2 |
| Molecular Weight | 198.46 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane |
| SMILES | C[Si](C)(C)/C=C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C10H22Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h7-10H,1-6H3/b9-7+,10-8+ |
| InChIKey | KTDRTOYQXRJJTE-FIFLTTCUSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane?
The IUPAC name of trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane (CID 5463026) is trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane.
What is the SMILES notation for trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane?
The canonical SMILES for trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane is C[Si](C)(C)/C=C/C=C/[Si](C)(C)C.
What is the InChIKey of trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane?
The InChIKey is KTDRTOYQXRJJTE-FIFLTTCUSA-N. The full InChI is InChI=1S/C10H22Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h7-10H,1-6H3/b9-7+,10-8+.
What are the key properties of trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane?
trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane has a molecular weight of 198.46 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]silane is sourced from PubChem (CID 5463026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).