C29H31N3O5S — CID 54630587
N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-phenylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylpyridine-2-carboxamide (PubChem CID 54630587) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-phenylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylpyridine-2-carboxamide.
| Compound Name | N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-phenylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 54630587 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-phenylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylpyridine-2-carboxamide |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#Cc3ccccc3)cc2O[C@@H]1CN(C)C(=O)c1ccccn1 |
| InChI | InChI=1S/C29H31N3O5S/c1-21-18-32(22(2)20-33)38(35,36)28-15-14-24(13-12-23-9-5-4-6-10-23)17-26(28)37-27(21)19-31(3)29(34)25-11-7-8-16-30-25/h4-11,14-17,21-22,27,33H,18-20H2,1-3H3/t21-,22-,27-/m1/s1 |
| InChIKey | OLHFYSBAVZSGEZ-VHFRWLAGSA-N |
| XLogP | 3.02 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|