C27H34N4O4 — CID 54630741
1-[[(2R,3S)-8-(cyclopenten-1-yl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-phenylurea (PubChem CID 54630741) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-[[(2R,3S)-8-(cyclopenten-1-yl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-phenylurea.
| Compound Name | 1-[[(2R,3S)-8-(cyclopenten-1-yl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-phenylurea |
|---|---|
| PubChem CID | 54630741 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-[[(2R,3S)-8-(cyclopenten-1-yl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-phenylurea |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)C(=O)Nc2ccccc2)Oc2ncc(C3=CCCC3)cc2C1=O |
| InChI | InChI=1S/C27H34N4O4/c1-18-15-31(19(2)17-32)26(33)23-13-21(20-9-7-8-10-20)14-28-25(23)35-24(18)16-30(3)27(34)29-22-11-5-4-6-12-22/h4-6,9,11-14,18-19,24,32H,7-8,10,15-17H2,1-3H3,(H,29,34)/t18-,19+,24-/m0/s1 |
| InChIKey | JJOVWKSYGTVCJK-GLDPYIMESA-N |
| XLogP | 4.03 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |