C26H39N5O4 — CID 54631116
3-cyclopentyl-1-[[(2S,3S)-8-[3-(dimethylamino)prop-1-ynyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea (PubChem CID 54631116) has the molecular formula C26H39N5O4 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-cyclopentyl-1-[[(2S,3S)-8-[3-(dimethylamino)prop-1-ynyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea.
| Compound Name | 3-cyclopentyl-1-[[(2S,3S)-8-[3-(dimethylamino)prop-1-ynyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 54631116 |
| Molecular Formula | C26H39N5O4 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-cyclopentyl-1-[[(2S,3S)-8-[3-(dimethylamino)prop-1-ynyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methylurea |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C(=O)NC2CCCC2)Oc2ncc(C#CCN(C)C)cc2C1=O |
| InChI | InChI=1S/C26H39N5O4/c1-18-15-31(19(2)17-32)25(33)22-13-20(9-8-12-29(3)4)14-27-24(22)35-23(18)16-30(5)26(34)28-21-10-6-7-11-21/h13-14,18-19,21,23,32H,6-7,10-12,15-17H2,1-5H3,(H,28,34)/t18-,19+,23+/m0/s1 |
| InChIKey | ZWFHMZQQRKTIKS-YCRNBWNJSA-N |
| XLogP | 1.80 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|