C6H7F6N — CID 5463142
(Z)-1,1,1,4,4,4-hexafluoro-N,N-dimethylbut-2-en-2-amine (PubChem CID 5463142) has the molecular formula C6H7F6N and a molecular weight of 207.12 g/mol. Its IUPAC name is (Z)-1,1,1,4,4,4-hexafluoro-N,N-dimethylbut-2-en-2-amine.
| Compound Name | (Z)-1,1,1,4,4,4-hexafluoro-N,N-dimethylbut-2-en-2-amine |
|---|---|
| PubChem CID | 5463142 |
| Molecular Formula | C6H7F6N |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (Z)-1,1,1,4,4,4-hexafluoro-N,N-dimethylbut-2-en-2-amine |
| SMILES | CN(C)/C(=C\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6N/c1-13(2)4(6(10,11)12)3-5(7,8)9/h3H,1-2H3/b4-3- |
| InChIKey | JMEOONFZWPEJCO-ARJAWSKDSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |