C4Cl4F4 — CID 5463150
(Z)-1,3,4,4-tetrachloro-1,2,3,4-tetrafluorobut-1-ene (PubChem CID 5463150) has the molecular formula C4Cl4F4 and a molecular weight of 265.85 g/mol. Its IUPAC name is (Z)-1,3,4,4-tetrachloro-1,2,3,4-tetrafluorobut-1-ene.
| Compound Name | (Z)-1,3,4,4-tetrachloro-1,2,3,4-tetrafluorobut-1-ene |
|---|---|
| PubChem CID | 5463150 |
| Molecular Formula | C4Cl4F4 |
| Molecular Weight | 265.85 g/mol |
| Exact Mass | 263.87 |
| IUPAC Name | (Z)-1,3,4,4-tetrachloro-1,2,3,4-tetrafluorobut-1-ene |
| SMILES | F/C(Cl)=C(/F)C(F)(Cl)C(F)(Cl)Cl |
| InChI | InChI=1S/C4Cl4F4/c5-2(10)1(9)3(6,11)4(7,8)12/b2-1+ |
| InChIKey | CYLIGQKNBPAGBL-OWOJBTEDSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|