C18H14N4O2 — CID 5463174
(2E,6E)-2,6-bis(phenylhydrazinylidene)cyclohex-4-ene-1,3-dione (PubChem CID 5463174) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (2E,6E)-2,6-bis(phenylhydrazinylidene)cyclohex-4-ene-1,3-dione.
| Compound Name | (2E,6E)-2,6-bis(phenylhydrazinylidene)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 5463174 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2E,6E)-2,6-bis(phenylhydrazinylidene)cyclohex-4-ene-1,3-dione |
| SMILES | O=c1cc/c(=N\Nc2ccccc2)c(=O)/c1=N/Nc1ccccc1 |
| InChI | InChI=1S/C18H14N4O2/c23-16-12-11-15(21-19-13-7-3-1-4-8-13)18(24)17(16)22-20-14-9-5-2-6-10-14/h1-12,19-20H/b21-15+,22-17+ |
| InChIKey | NDLIECNOSIXXSC-NDDVQLSCSA-N |
| XLogP | 1.14 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|