About N-butylethanesulfinamide
N-butylethanesulfinamide (PubChem CID 546320) has the molecular formula C6H15NOS
and a molecular weight of 149.26 g/mol. Its IUPAC name is N-butylethanesulfinamide.
Molecular Properties
| Compound Name | N-butylethanesulfinamide |
| PubChem CID | 546320 |
| Molecular Formula | C6H15NOS |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | N-butylethanesulfinamide |
| SMILES | CCCCNS(=O)CC |
| InChI | InChI=1S/C6H15NOS/c1-3-5-6-7-9(8)4-2/h7H,3-6H2,1-2H3 |
| InChIKey | DXZBYFSOTAJPRI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylethanesulfinamide?
The IUPAC name of N-butylethanesulfinamide (CID 546320) is N-butylethanesulfinamide.
What is the SMILES notation for N-butylethanesulfinamide?
The canonical SMILES for N-butylethanesulfinamide is CCCCNS(=O)CC.
What is the InChIKey of N-butylethanesulfinamide?
The InChIKey is DXZBYFSOTAJPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NOS/c1-3-5-6-7-9(8)4-2/h7H,3-6H2,1-2H3.
What are the key properties of N-butylethanesulfinamide?
N-butylethanesulfinamide has a molecular weight of 149.26 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylethanesulfinamide is sourced from PubChem (CID 546320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).