About [(E)-3,3-dimethoxyprop-1-enyl]benzene
[(E)-3,3-dimethoxyprop-1-enyl]benzene (PubChem CID 5463228) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is [(E)-3,3-dimethoxyprop-1-enyl]benzene.
Molecular Properties
| Compound Name | [(E)-3,3-dimethoxyprop-1-enyl]benzene |
| PubChem CID | 5463228 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | [(E)-3,3-dimethoxyprop-1-enyl]benzene |
| SMILES | COC(/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C11H14O2/c1-12-11(13-2)9-8-10-6-4-3-5-7-10/h3-9,11H,1-2H3/b9-8+ |
| InChIKey | MBAOABFNWSOOLU-CMDGGOBGSA-N |
| XLogP | 2.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,3-dimethoxyprop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,3-dimethoxyprop-1-enyl]benzene?
The IUPAC name of [(E)-3,3-dimethoxyprop-1-enyl]benzene (CID 5463228) is [(E)-3,3-dimethoxyprop-1-enyl]benzene.
What is the SMILES notation for [(E)-3,3-dimethoxyprop-1-enyl]benzene?
The canonical SMILES for [(E)-3,3-dimethoxyprop-1-enyl]benzene is COC(/C=C/c1ccccc1)OC.
What is the InChIKey of [(E)-3,3-dimethoxyprop-1-enyl]benzene?
The InChIKey is MBAOABFNWSOOLU-CMDGGOBGSA-N. The full InChI is InChI=1S/C11H14O2/c1-12-11(13-2)9-8-10-6-4-3-5-7-10/h3-9,11H,1-2H3/b9-8+.
What are the key properties of [(E)-3,3-dimethoxyprop-1-enyl]benzene?
[(E)-3,3-dimethoxyprop-1-enyl]benzene has a molecular weight of 178.23 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,3-dimethoxyprop-1-enyl]benzene is sourced from PubChem (CID 5463228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).