C24H39N3O6S — CID 54632334
N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-5-(oxan-4-ylmethyl)-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]methanesulfonamide (PubChem CID 54632334) has the molecular formula C24H39N3O6S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-5-(oxan-4-ylmethyl)-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]methanesulfonamide.
| Compound Name | N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-5-(oxan-4-ylmethyl)-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]methanesulfonamide |
|---|---|
| PubChem CID | 54632334 |
| Molecular Formula | C24H39N3O6S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-5-(oxan-4-ylmethyl)-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]methanesulfonamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NS(C)(=O)=O)ccc2OC[C@@H](C)N(CC2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C24H39N3O6S/c1-17-13-27(14-19-8-10-32-11-9-19)18(2)16-33-22-7-6-20(25-34(5,29)30)12-21(22)24(28)26(3)15-23(17)31-4/h6-7,12,17-19,23,25H,8-11,13-16H2,1-5H3/t17-,18+,23+/m0/s1 |
| InChIKey | PYPATSURXBWVGX-YZZKKUAISA-N |
| XLogP | 2.29 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |