C19H31N3O7S2 — CID 54632584
N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-5-methylsulfonyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]methanesulfonamide (PubChem CID 54632584) has the molecular formula C19H31N3O7S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-5-methylsulfonyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-5-methylsulfonyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 54632584 |
| Molecular Formula | C19H31N3O7S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-5-methylsulfonyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]methanesulfonamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NS(C)(=O)=O)cc2OC[C@H](C)N(S(C)(=O)=O)C[C@H]1C |
| InChI | InChI=1S/C19H31N3O7S2/c1-13-10-22(31(6,26)27)14(2)12-29-17-9-15(20-30(5,24)25)7-8-16(17)19(23)21(3)11-18(13)28-4/h7-9,13-14,18,20H,10-12H2,1-6H3/t13-,14+,18-/m1/s1 |
| InChIKey | JZZOEAQFGXAXSL-QWQRMKEZSA-N |
| XLogP | 0.82 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |