C28H36FN3O4 — CID 54632787
N-[(4S,7R,8S)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-fluorobenzamide (PubChem CID 54632787) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is N-[(4S,7R,8S)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-fluorobenzamide.
| Compound Name | N-[(4S,7R,8S)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 54632787 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[(4S,7R,8S)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-fluorobenzamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2OC[C@H](C)N(CC2CC2)C[C@H]1C |
| InChI | InChI=1S/C28H36FN3O4/c1-18-14-32(15-20-8-9-20)19(2)17-36-25-13-23(30-27(33)21-6-5-7-22(29)12-21)10-11-24(25)28(34)31(3)16-26(18)35-4/h5-7,10-13,18-20,26H,8-9,14-17H2,1-4H3,(H,30,33)/t18-,19+,26-/m1/s1 |
| InChIKey | QXMKZAKCOIHKOR-UYXZNNOOSA-N |
| XLogP | 4.29 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |