About 3-bromo-1-benzothiophene 1-oxide
3-bromo-1-benzothiophene 1-oxide (PubChem CID 5463323) has the molecular formula C8H5BrOS
and a molecular weight of 229.10 g/mol. Its IUPAC name is 3-bromo-1-benzothiophene 1-oxide.
Molecular Properties
| Compound Name | 3-bromo-1-benzothiophene 1-oxide |
| PubChem CID | 5463323 |
| Molecular Formula | C8H5BrOS |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 227.92 |
| IUPAC Name | 3-bromo-1-benzothiophene 1-oxide |
| SMILES | O=S1C=C(Br)c2ccccc21 |
| InChI | InChI=1S/C8H5BrOS/c9-7-5-11(10)8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | YTVZKVHWKLMFEG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-1-benzothiophene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-benzothiophene 1-oxide?
The IUPAC name of 3-bromo-1-benzothiophene 1-oxide (CID 5463323) is 3-bromo-1-benzothiophene 1-oxide.
What is the SMILES notation for 3-bromo-1-benzothiophene 1-oxide?
The canonical SMILES for 3-bromo-1-benzothiophene 1-oxide is O=S1C=C(Br)c2ccccc21.
What is the InChIKey of 3-bromo-1-benzothiophene 1-oxide?
The InChIKey is YTVZKVHWKLMFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrOS/c9-7-5-11(10)8-4-2-1-3-6(7)8/h1-5H.
What are the key properties of 3-bromo-1-benzothiophene 1-oxide?
3-bromo-1-benzothiophene 1-oxide has a molecular weight of 229.10 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-benzothiophene 1-oxide is sourced from PubChem (CID 5463323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).