About 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide
1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide (PubChem CID 5463368) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide |
| PubChem CID | 5463368 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C=C/N1CCCC1C(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-2-3-6-11-7-4-5-8(11)9(10)12/h2-3,6,8H,1,4-5,7H2,(H2,10,12)/b6-3+ |
| InChIKey | AOEFTBNCQMQBOY-ZZXKWVIFSA-N |
| XLogP | 0.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide?
The IUPAC name of 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide (CID 5463368) is 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide is C=C/C=C/N1CCCC1C(N)=O.
What is the InChIKey of 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide?
The InChIKey is AOEFTBNCQMQBOY-ZZXKWVIFSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-3-6-11-7-4-5-8(11)9(10)12/h2-3,6,8H,1,4-5,7H2,(H2,10,12)/b6-3+.
What are the key properties of 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide?
1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide has a molecular weight of 166.22 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-buta-1,3-dienyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 5463368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).