About (3E)-3,7-dimethylocta-1,3-diene
(3E)-3,7-dimethylocta-1,3-diene (PubChem CID 5463450) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is (3E)-3,7-dimethylocta-1,3-diene.
Molecular Properties
| Compound Name | (3E)-3,7-dimethylocta-1,3-diene |
| PubChem CID | 5463450 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (3E)-3,7-dimethylocta-1,3-diene |
| SMILES | C=C/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,8-9H,1,6-7H2,2-4H3/b10-8+ |
| InChIKey | WUIFRGYQELQKDN-CSKARUKUSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3,7-dimethylocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3,7-dimethylocta-1,3-diene?
The IUPAC name of (3E)-3,7-dimethylocta-1,3-diene (CID 5463450) is (3E)-3,7-dimethylocta-1,3-diene.
What is the SMILES notation for (3E)-3,7-dimethylocta-1,3-diene?
The canonical SMILES for (3E)-3,7-dimethylocta-1,3-diene is C=C/C(C)=C/CCC(C)C.
What is the InChIKey of (3E)-3,7-dimethylocta-1,3-diene?
The InChIKey is WUIFRGYQELQKDN-CSKARUKUSA-N. The full InChI is InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,8-9H,1,6-7H2,2-4H3/b10-8+.
What are the key properties of (3E)-3,7-dimethylocta-1,3-diene?
(3E)-3,7-dimethylocta-1,3-diene has a molecular weight of 138.25 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3,7-dimethylocta-1,3-diene is sourced from PubChem (CID 5463450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).