C31H33F2N3O5 — CID 54634757
4-fluoro-N-[(4R,7R,8S)-5-(4-fluorobenzoyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzamide (PubChem CID 54634757) has the molecular formula C31H33F2N3O5 and a molecular weight of 565.62 g/mol. Its IUPAC name is 4-fluoro-N-[(4R,7R,8S)-5-(4-fluorobenzoyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzamide.
| Compound Name | 4-fluoro-N-[(4R,7R,8S)-5-(4-fluorobenzoyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzamide |
|---|---|
| PubChem CID | 54634757 |
| Molecular Formula | C31H33F2N3O5 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 4-fluoro-N-[(4R,7R,8S)-5-(4-fluorobenzoyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NC(=O)c3ccc(F)cc3)cc2OC[C@@H](C)N(C(=O)c2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C31H33F2N3O5/c1-19-16-36(30(38)22-7-11-24(33)12-8-22)20(2)18-41-27-15-25(34-29(37)21-5-9-23(32)10-6-21)13-14-26(27)31(39)35(3)17-28(19)40-4/h5-15,19-20,28H,16-18H2,1-4H3,(H,34,37)/t19-,20-,28-/m1/s1 |
| InChIKey | JMRLBNIXEXNYJG-NCXSOUSFSA-N |
| XLogP | 4.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |