About tert-butyl 2-phenylsulfanylacetate
tert-butyl 2-phenylsulfanylacetate (PubChem CID 546353) has the molecular formula C12H16O2S
and a molecular weight of 224.32 g/mol. Its IUPAC name is tert-butyl 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | tert-butyl 2-phenylsulfanylacetate |
| PubChem CID | 546353 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | tert-butyl 2-phenylsulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c1-12(2,3)14-11(13)9-15-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | DCBFWYUEVNDENZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-phenylsulfanylacetate?
The IUPAC name of tert-butyl 2-phenylsulfanylacetate (CID 546353) is tert-butyl 2-phenylsulfanylacetate.
What is the SMILES notation for tert-butyl 2-phenylsulfanylacetate?
The canonical SMILES for tert-butyl 2-phenylsulfanylacetate is CC(C)(C)OC(=O)CSc1ccccc1.
What is the InChIKey of tert-butyl 2-phenylsulfanylacetate?
The InChIKey is DCBFWYUEVNDENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S/c1-12(2,3)14-11(13)9-15-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3.
What are the key properties of tert-butyl 2-phenylsulfanylacetate?
tert-butyl 2-phenylsulfanylacetate has a molecular weight of 224.32 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-phenylsulfanylacetate is sourced from PubChem (CID 546353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).