About 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol
4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol (PubChem CID 546355) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
| PubChem CID | 546355 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)C1CCC(O)CC1 |
| InChI | InChI=1S/C14H28O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | FTFGPKGCCXQMJL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The IUPAC name of 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol (CID 546355) is 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The canonical SMILES for 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol is CC(C)(C)CC(C)(C)C1CCC(O)CC1.
What is the InChIKey of 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The InChIKey is FTFGPKGCCXQMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h11-12,15H,6-10H2,1-5H3.
What are the key properties of 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol has a molecular weight of 212.38 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 546355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).