C26H33FN4O5 — CID 54635553
1-[(4R,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-(2-fluorophenyl)urea (PubChem CID 54635553) has the molecular formula C26H33FN4O5 and a molecular weight of 500.57 g/mol. Its IUPAC name is 1-[(4R,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(4R,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 54635553 |
| Molecular Formula | C26H33FN4O5 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-[(4R,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-3-(2-fluorophenyl)urea |
| SMILES | CO[C@H]1CN(C)C(=O)c2ccc(NC(=O)Nc3ccccc3F)cc2OC[C@@H](C)N(C(C)=O)C[C@H]1C |
| InChI | InChI=1S/C26H33FN4O5/c1-16-13-31(18(3)32)17(2)15-36-23-12-19(28-26(34)29-22-9-7-6-8-21(22)27)10-11-20(23)25(33)30(4)14-24(16)35-5/h6-12,16-17,24H,13-15H2,1-5H3,(H2,28,29,34)/t16-,17-,24+/m1/s1 |
| InChIKey | FKHYGSSSYDJVPK-OJLQRUNKSA-N |
| XLogP | 3.82 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |