About N-(3-methoxyphenyl)-2,2-dimethylpropanamide
N-(3-methoxyphenyl)-2,2-dimethylpropanamide (PubChem CID 546358) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2,2-dimethylpropanamide |
| PubChem CID | 546358 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(3-methoxyphenyl)-2,2-dimethylpropanamide |
| SMILES | COc1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-12(2,3)11(14)13-9-6-5-7-10(8-9)15-4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | DAFHCFQPQMYDFI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-methoxyphenyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(3-methoxyphenyl)-2,2-dimethylpropanamide (CID 546358) is N-(3-methoxyphenyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(3-methoxyphenyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(3-methoxyphenyl)-2,2-dimethylpropanamide is COc1cccc(NC(=O)C(C)(C)C)c1.
What is the InChIKey of N-(3-methoxyphenyl)-2,2-dimethylpropanamide?
The InChIKey is DAFHCFQPQMYDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-12(2,3)11(14)13-9-6-5-7-10(8-9)15-4/h5-8H,1-4H3,(H,13,14).
What are the key properties of N-(3-methoxyphenyl)-2,2-dimethylpropanamide?
N-(3-methoxyphenyl)-2,2-dimethylpropanamide has a molecular weight of 207.27 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 546358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).