About [(E)-hex-3-enyl] 3-chloropropanoate
[(E)-hex-3-enyl] 3-chloropropanoate (PubChem CID 5463677) has the molecular formula C9H15ClO2
and a molecular weight of 190.67 g/mol. Its IUPAC name is [(E)-hex-3-enyl] 3-chloropropanoate.
Molecular Properties
| Compound Name | [(E)-hex-3-enyl] 3-chloropropanoate |
| PubChem CID | 5463677 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | [(E)-hex-3-enyl] 3-chloropropanoate |
| SMILES | CC/C=C/CCOC(=O)CCCl |
| InChI | InChI=1S/C9H15ClO2/c1-2-3-4-5-8-12-9(11)6-7-10/h3-4H,2,5-8H2,1H3/b4-3+ |
| InChIKey | RCTBGSWMRQJSLJ-ONEGZZNKSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-3-enyl] 3-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-3-enyl] 3-chloropropanoate?
The IUPAC name of [(E)-hex-3-enyl] 3-chloropropanoate (CID 5463677) is [(E)-hex-3-enyl] 3-chloropropanoate.
What is the SMILES notation for [(E)-hex-3-enyl] 3-chloropropanoate?
The canonical SMILES for [(E)-hex-3-enyl] 3-chloropropanoate is CC/C=C/CCOC(=O)CCCl.
What is the InChIKey of [(E)-hex-3-enyl] 3-chloropropanoate?
The InChIKey is RCTBGSWMRQJSLJ-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H15ClO2/c1-2-3-4-5-8-12-9(11)6-7-10/h3-4H,2,5-8H2,1H3/b4-3+.
What are the key properties of [(E)-hex-3-enyl] 3-chloropropanoate?
[(E)-hex-3-enyl] 3-chloropropanoate has a molecular weight of 190.67 g/mol, XLogP of 2.51, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-3-enyl] 3-chloropropanoate is sourced from PubChem (CID 5463677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).