About 2-(2-hydroxyethylamino)-4,6-dinitrophenol
2-(2-hydroxyethylamino)-4,6-dinitrophenol (PubChem CID 5463814) has the molecular formula C8H9N3O6
and a molecular weight of 243.17 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-4,6-dinitrophenol.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylamino)-4,6-dinitrophenol |
| PubChem CID | 5463814 |
| Molecular Formula | C8H9N3O6 |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(2-hydroxyethylamino)-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(NCCO)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9N3O6/c12-2-1-9-6-3-5(10(14)15)4-7(8(6)13)11(16)17/h3-4,9,12-13H,1-2H2 |
| InChIKey | OABRBVCUJIJMOB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylamino)-4,6-dinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylamino)-4,6-dinitrophenol?
The IUPAC name of 2-(2-hydroxyethylamino)-4,6-dinitrophenol (CID 5463814) is 2-(2-hydroxyethylamino)-4,6-dinitrophenol.
What is the SMILES notation for 2-(2-hydroxyethylamino)-4,6-dinitrophenol?
The canonical SMILES for 2-(2-hydroxyethylamino)-4,6-dinitrophenol is O=[N+]([O-])c1cc(NCCO)c(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-(2-hydroxyethylamino)-4,6-dinitrophenol?
The InChIKey is OABRBVCUJIJMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O6/c12-2-1-9-6-3-5(10(14)15)4-7(8(6)13)11(16)17/h3-4,9,12-13H,1-2H2.
What are the key properties of 2-(2-hydroxyethylamino)-4,6-dinitrophenol?
2-(2-hydroxyethylamino)-4,6-dinitrophenol has a molecular weight of 243.17 g/mol, XLogP of 0.61, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylamino)-4,6-dinitrophenol is sourced from PubChem (CID 5463814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).