C11H19BrO2 — CID 546382
4-bromo-2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 546382) has the molecular formula C11H19BrO2 and a molecular weight of 263.17 g/mol. Its IUPAC name is 4-bromo-2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | 4-bromo-2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 546382 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-bromo-2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)C(Br)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H19BrO2/c1-10(2,3)8(13)7(12)9(14)11(4,5)6/h7H,1-6H3 |
| InChIKey | NTOGOGNZILHZOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|