About 2,6-dimethyloctanal
2,6-dimethyloctanal (PubChem CID 5463910) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2,6-dimethyloctanal.
Molecular Properties
| Compound Name | 2,6-dimethyloctanal |
| PubChem CID | 5463910 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2,6-dimethyloctanal |
| SMILES | CCC(C)CCCC(C)C=O |
| InChI | InChI=1S/C10H20O/c1-4-9(2)6-5-7-10(3)8-11/h8-10H,4-7H2,1-3H3 |
| InChIKey | CBOBADCVMLMQRW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyloctanal?
The IUPAC name of 2,6-dimethyloctanal (CID 5463910) is 2,6-dimethyloctanal.
What is the SMILES notation for 2,6-dimethyloctanal?
The canonical SMILES for 2,6-dimethyloctanal is CCC(C)CCCC(C)C=O.
What is the InChIKey of 2,6-dimethyloctanal?
The InChIKey is CBOBADCVMLMQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-4-9(2)6-5-7-10(3)8-11/h8-10H,4-7H2,1-3H3.
What are the key properties of 2,6-dimethyloctanal?
2,6-dimethyloctanal has a molecular weight of 156.27 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyloctanal is sourced from PubChem (CID 5463910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).