C36H70O14 — CID 5463919
2,3-dihydroxypropyl (E)-2,3,4,5-tetrakis(2,3-dihydroxypropyl)-20,21-dihydroxyhenicos-9-enoate (PubChem CID 5463919) has the molecular formula C36H70O14 and a molecular weight of 726.94 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (E)-2,3,4,5-tetrakis(2,3-dihydroxypropyl)-20,21-dihydroxyhenicos-9-enoate.
| Compound Name | 2,3-dihydroxypropyl (E)-2,3,4,5-tetrakis(2,3-dihydroxypropyl)-20,21-dihydroxyhenicos-9-enoate |
|---|---|
| PubChem CID | 5463919 |
| Molecular Formula | C36H70O14 |
| Molecular Weight | 726.94 g/mol |
| Exact Mass | 726.48 |
| IUPAC Name | 2,3-dihydroxypropyl (E)-2,3,4,5-tetrakis(2,3-dihydroxypropyl)-20,21-dihydroxyhenicos-9-enoate |
| SMILES | O=C(OCC(O)CO)C(CC(O)CO)C(CC(O)CO)C(CC(O)CO)C(CCC/C=C/CCCCCCCCCC(O)CO)CC(O)CO |
| InChI | InChI=1S/C36H70O14/c37-19-27(43)14-12-10-8-6-4-2-1-3-5-7-9-11-13-26(15-28(44)20-38)33(16-29(45)21-39)34(17-30(46)22-40)35(18-31(47)23-41)36(49)50-25-32(48)24-42/h5,7,26-35,37-48H,1-4,6,8-25H2/b7-5+ |
| InChIKey | RAIRMBHOCCUQAG-FNORWQNLSA-N |
| XLogP | -0.09 |
| TPSA | 269.06 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.94 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|