About (2E)-2-ethylidenehexanal
(2E)-2-ethylidenehexanal (PubChem CID 5463946) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (2E)-2-ethylidenehexanal.
Molecular Properties
| Compound Name | (2E)-2-ethylidenehexanal |
| PubChem CID | 5463946 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2E)-2-ethylidenehexanal |
| SMILES | C/C=C(/C=O)CCCC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-8(4-2)7-9/h4,7H,3,5-6H2,1-2H3/b8-4+ |
| InChIKey | RAPHJZMCZKGDSB-XBXARRHUSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethylidenehexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidenehexanal?
The IUPAC name of (2E)-2-ethylidenehexanal (CID 5463946) is (2E)-2-ethylidenehexanal.
What is the SMILES notation for (2E)-2-ethylidenehexanal?
The canonical SMILES for (2E)-2-ethylidenehexanal is C/C=C(/C=O)CCCC.
What is the InChIKey of (2E)-2-ethylidenehexanal?
The InChIKey is RAPHJZMCZKGDSB-XBXARRHUSA-N. The full InChI is InChI=1S/C8H14O/c1-3-5-6-8(4-2)7-9/h4,7H,3,5-6H2,1-2H3/b8-4+.
What are the key properties of (2E)-2-ethylidenehexanal?
(2E)-2-ethylidenehexanal has a molecular weight of 126.20 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidenehexanal is sourced from PubChem (CID 5463946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).