C26H25N3O4 — CID 54640302
N-[(2R,3S,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(4-phenylanilino)ethyl]-3,6-dihydro-2H-pyran-3-yl]pyridine-4-carboxamide (PubChem CID 54640302) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[(2R,3S,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(4-phenylanilino)ethyl]-3,6-dihydro-2H-pyran-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2R,3S,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(4-phenylanilino)ethyl]-3,6-dihydro-2H-pyran-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 54640302 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[(2R,3S,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(4-phenylanilino)ethyl]-3,6-dihydro-2H-pyran-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(C[C@@H]1C=C[C@H](NC(=O)c2ccncc2)[C@H](CO)O1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c30-17-24-23(29-26(32)20-12-14-27-15-13-20)11-10-22(33-24)16-25(31)28-21-8-6-19(7-9-21)18-4-2-1-3-5-18/h1-15,22-24,30H,16-17H2,(H,28,31)(H,29,32)/t22-,23-,24-/m0/s1 |
| InChIKey | WWBREHKQUAGTED-HJOGWXRNSA-N |
| XLogP | 3.19 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|