C21H24Cl2N4O5 — CID 54640347
N-[(3,4-dichlorophenyl)methyl]-2-[(2R,3R,6R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide (PubChem CID 54640347) has the molecular formula C21H24Cl2N4O5 and a molecular weight of 483.35 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-[(2R,3R,6R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-[(2R,3R,6R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide |
|---|---|
| PubChem CID | 54640347 |
| Molecular Formula | C21H24Cl2N4O5 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-[(2R,3R,6R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide |
| SMILES | Cc1noc(C)c1NC(=O)N[C@@H]1C=C[C@@H](CC(=O)NCc2ccc(Cl)c(Cl)c2)O[C@H]1CO |
| InChI | InChI=1S/C21H24Cl2N4O5/c1-11-20(12(2)32-27-11)26-21(30)25-17-6-4-14(31-18(17)10-28)8-19(29)24-9-13-3-5-15(22)16(23)7-13/h3-7,14,17-18,28H,8-10H2,1-2H3,(H,24,29)(H2,25,26,30)/t14-,17+,18-/m0/s1 |
| InChIKey | HMAQNEDPCLDOSX-QGTPRVQTSA-N |
| XLogP | 3.11 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|