C16H19NO5 — CID 54640624
methyl 2-[(2R,3R,6S)-3-benzamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 54640624) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl 2-[(2R,3R,6S)-3-benzamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,6S)-3-benzamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 54640624 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | methyl 2-[(2R,3R,6S)-3-benzamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@@H](NC(=O)c2ccccc2)[C@H](CO)O1 |
| InChI | InChI=1S/C16H19NO5/c1-21-15(19)9-12-7-8-13(14(10-18)22-12)17-16(20)11-5-3-2-4-6-11/h2-8,12-14,18H,9-10H2,1H3,(H,17,20)/t12-,13-,14+/m1/s1 |
| InChIKey | GVTOYTHYWUUIIC-MCIONIFRSA-N |
| XLogP | 0.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|