C10H6F7N3O3 — CID 5464091
N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 5464091) has the molecular formula C10H6F7N3O3 and a molecular weight of 349.16 g/mol. Its IUPAC name is N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 5464091 |
| Molecular Formula | C10H6F7N3O3 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | Nc1c(NC(=O)C(F)(F)C(F)F)cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6F7N3O3/c11-7(12)9(13,14)8(21)19-4-1-3(10(15,16)17)2-5(6(4)18)20(22)23/h1-2,7H,18H2,(H,19,21) |
| InChIKey | YUANPWFOQAEKNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|