C19H28N4O4S — CID 54640922
N-[(2R,3R,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,6-dihydro-2H-pyran-3-yl]-3-piperidin-1-ylpropanamide (PubChem CID 54640922) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[(2R,3R,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,6-dihydro-2H-pyran-3-yl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(2R,3R,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,6-dihydro-2H-pyran-3-yl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 54640922 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[(2R,3R,6R)-2-(hydroxymethyl)-6-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,6-dihydro-2H-pyran-3-yl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(C[C@@H]1C=C[C@@H](NC(=O)CCN2CCCCC2)[C@H](CO)O1)Nc1nccs1 |
| InChI | InChI=1S/C19H28N4O4S/c24-13-16-15(21-17(25)6-10-23-8-2-1-3-9-23)5-4-14(27-16)12-18(26)22-19-20-7-11-28-19/h4-5,7,11,14-16,24H,1-3,6,8-10,12-13H2,(H,21,25)(H,20,22,26)/t14-,15+,16-/m0/s1 |
| InChIKey | DDEXDZVSNNOFMF-XHSDSOJGSA-N |
| XLogP | 1.15 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|