C22H32F2N4O5 — CID 54641424
2-[(2S,5S,6S)-5-[(2,5-difluorophenyl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 54641424) has the molecular formula C22H32F2N4O5 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[(2S,5S,6S)-5-[(2,5-difluorophenyl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[(2S,5S,6S)-5-[(2,5-difluorophenyl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 54641424 |
| Molecular Formula | C22H32F2N4O5 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[(2S,5S,6S)-5-[(2,5-difluorophenyl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H](NC(=O)Nc2cc(F)ccc2F)[C@@H](CO)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C22H32F2N4O5/c23-15-2-4-17(24)19(12-15)27-22(31)26-18-5-3-16(33-20(18)14-29)13-21(30)25-6-1-7-28-8-10-32-11-9-28/h2,4,12,16,18,20,29H,1,3,5-11,13-14H2,(H,25,30)(H2,26,27,31)/t16-,18-,20+/m0/s1 |
| InChIKey | NMJCGGDCVBJZJZ-XKGZKEIXSA-N |
| XLogP | 1.22 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|