C21H28N2O4 — CID 54642946
N-[(2S,3R,6S)-2-(hydroxymethyl)-6-(2-oxo-2-piperidin-1-ylethyl)-3,6-dihydro-2H-pyran-3-yl]-2-phenylacetamide (PubChem CID 54642946) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(2S,3R,6S)-2-(hydroxymethyl)-6-(2-oxo-2-piperidin-1-ylethyl)-3,6-dihydro-2H-pyran-3-yl]-2-phenylacetamide.
| Compound Name | N-[(2S,3R,6S)-2-(hydroxymethyl)-6-(2-oxo-2-piperidin-1-ylethyl)-3,6-dihydro-2H-pyran-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 54642946 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[(2S,3R,6S)-2-(hydroxymethyl)-6-(2-oxo-2-piperidin-1-ylethyl)-3,6-dihydro-2H-pyran-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C=C[C@H](CC(=O)N2CCCCC2)O[C@@H]1CO |
| InChI | InChI=1S/C21H28N2O4/c24-15-19-18(22-20(25)13-16-7-3-1-4-8-16)10-9-17(27-19)14-21(26)23-11-5-2-6-12-23/h1,3-4,7-10,17-19,24H,2,5-6,11-15H2,(H,22,25)/t17-,18-,19-/m1/s1 |
| InChIKey | CGRFWBPSIYMFCM-GUDVDZBRSA-N |
| XLogP | 1.43 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|