About CID 5464340
CID 5464340 (PubChem CID 5464340) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol.
Molecular Properties
| Compound Name | CID 5464340 |
| PubChem CID | 5464340 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | — |
| SMILES | [NH]CC1(C[NH])CCCCC1 |
| InChI | InChI=1S/C8H16N2/c9-6-8(7-10)4-2-1-3-5-8/h9-10H,1-7H2 |
| InChIKey | ALPRNCBZKREXHO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5464340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5464340?
The IUPAC name of CID 5464340 (CID 5464340) is not available.
What is the SMILES notation for CID 5464340?
The canonical SMILES for CID 5464340 is [NH]CC1(C[NH])CCCCC1.
What is the InChIKey of CID 5464340?
The InChIKey is ALPRNCBZKREXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c9-6-8(7-10)4-2-1-3-5-8/h9-10H,1-7H2.
What are the key properties of CID 5464340?
CID 5464340 has a molecular weight of 140.23 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5464340 is sourced from PubChem (CID 5464340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).