C19H30FN3O5S — CID 54643763
N-[3-(dimethylamino)propyl]-2-[(2R,5S,6S)-5-[(4-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide (PubChem CID 54643763) has the molecular formula C19H30FN3O5S and a molecular weight of 431.53 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[(2R,5S,6S)-5-[(4-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[(2R,5S,6S)-5-[(4-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 54643763 |
| Molecular Formula | C19H30FN3O5S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[(2R,5S,6S)-5-[(4-fluorophenyl)sulfonylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide |
| SMILES | CN(C)CCCNC(=O)C[C@H]1CC[C@H](NS(=O)(=O)c2ccc(F)cc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C19H30FN3O5S/c1-23(2)11-3-10-21-19(25)12-15-6-9-17(18(13-24)28-15)22-29(26,27)16-7-4-14(20)5-8-16/h4-5,7-8,15,17-18,22,24H,3,6,9-13H2,1-2H3,(H,21,25)/t15-,17+,18-/m1/s1 |
| InChIKey | ULDPNUVREOZCAV-BPQIPLTHSA-N |
| XLogP | 0.47 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|