About 7-amino-1H-1,8-naphthyridin-2-one
7-amino-1H-1,8-naphthyridin-2-one (PubChem CID 5464536) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 7-amino-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-amino-1H-1,8-naphthyridin-2-one |
| PubChem CID | 5464536 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 7-amino-1H-1,8-naphthyridin-2-one |
| SMILES | Nc1ccc2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C8H7N3O/c9-6-3-1-5-2-4-7(12)11-8(5)10-6/h1-4H,(H3,9,10,11,12) |
| InChIKey | NSPQTGOJGZXAJM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-amino-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1H-1,8-naphthyridin-2-one?
The IUPAC name of 7-amino-1H-1,8-naphthyridin-2-one (CID 5464536) is 7-amino-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 7-amino-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 7-amino-1H-1,8-naphthyridin-2-one is Nc1ccc2ccc(=O)[nH]c2n1.
What is the InChIKey of 7-amino-1H-1,8-naphthyridin-2-one?
The InChIKey is NSPQTGOJGZXAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-6-3-1-5-2-4-7(12)11-8(5)10-6/h1-4H,(H3,9,10,11,12).
What are the key properties of 7-amino-1H-1,8-naphthyridin-2-one?
7-amino-1H-1,8-naphthyridin-2-one has a molecular weight of 161.16 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 5464536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).