C24H27FN2O6 — CID 54646796
2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(2-methoxyacetyl)amino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 54646796) has the molecular formula C24H27FN2O6 and a molecular weight of 458.49 g/mol. Its IUPAC name is 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(2-methoxyacetyl)amino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(2-methoxyacetyl)amino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54646796 |
| Molecular Formula | C24H27FN2O6 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(2-methoxyacetyl)amino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | COCC(=O)Nc1ccc2c(c1)[C@@H]1C[C@@H](CC(=O)NCc3cccc(F)c3)O[C@H](CO)[C@@H]1O2 |
| InChI | InChI=1S/C24H27FN2O6/c1-31-13-23(30)27-16-5-6-20-18(8-16)19-9-17(32-21(12-28)24(19)33-20)10-22(29)26-11-14-3-2-4-15(25)7-14/h2-8,17,19,21,24,28H,9-13H2,1H3,(H,26,29)(H,27,30)/t17-,19-,21+,24+/m0/s1 |
| InChIKey | XXGMCPLWTXDZMN-NOOBJOLFSA-N |
| XLogP | 2.11 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |