C33H37N3O6 — CID 54646959
2-[(1R,3R,4aS,9aR)-6-(cyclopentylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenoxyphenyl)methyl]acetamide (PubChem CID 54646959) has the molecular formula C33H37N3O6 and a molecular weight of 571.67 g/mol. Its IUPAC name is 2-[(1R,3R,4aS,9aR)-6-(cyclopentylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(1R,3R,4aS,9aR)-6-(cyclopentylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54646959 |
| Molecular Formula | C33H37N3O6 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 2-[(1R,3R,4aS,9aR)-6-(cyclopentylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
| SMILES | O=C(C[C@H]1C[C@H]2c3cc(NC(=O)NC4CCCC4)ccc3O[C@H]2[C@@H](CO)O1)NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H37N3O6/c37-20-30-32-28(27-16-23(12-15-29(27)42-32)36-33(39)35-22-6-4-5-7-22)17-26(41-30)18-31(38)34-19-21-10-13-25(14-11-21)40-24-8-2-1-3-9-24/h1-3,8-16,22,26,28,30,32,37H,4-7,17-20H2,(H,34,38)(H2,35,36,39)/t26-,28+,30-,32-/m1/s1 |
| InChIKey | DAHXJGYEMVSBKQ-WJDOUZETSA-N |
| XLogP | 5.24 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |