About 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate
1-tert-butylsulfanyloctan-2-yl 2-chloroacetate (PubChem CID 546474) has the molecular formula C14H27ClO2S
and a molecular weight of 294.89 g/mol. Its IUPAC name is 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate |
| PubChem CID | 546474 |
| Molecular Formula | C14H27ClO2S |
| Molecular Weight | 294.89 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate |
| SMILES | CCCCCCC(CSC(C)(C)C)OC(=O)CCl |
| InChI | InChI=1S/C14H27ClO2S/c1-5-6-7-8-9-12(17-13(16)10-15)11-18-14(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | RFUNQWDIAAVNHB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate?
The IUPAC name of 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate (CID 546474) is 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate.
What is the SMILES notation for 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate?
The canonical SMILES for 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate is CCCCCCC(CSC(C)(C)C)OC(=O)CCl.
What is the InChIKey of 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate?
The InChIKey is RFUNQWDIAAVNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27ClO2S/c1-5-6-7-8-9-12(17-13(16)10-15)11-18-14(2,3)4/h12H,5-11H2,1-4H3.
What are the key properties of 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate?
1-tert-butylsulfanyloctan-2-yl 2-chloroacetate has a molecular weight of 294.89 g/mol, XLogP of 4.64, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyloctan-2-yl 2-chloroacetate is sourced from PubChem (CID 546474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).