C22H25NO8S — CID 54648042
methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(4-methoxyphenyl)sulfonylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate (PubChem CID 54648042) has the molecular formula C22H25NO8S and a molecular weight of 463.51 g/mol. Its IUPAC name is methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(4-methoxyphenyl)sulfonylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(4-methoxyphenyl)sulfonylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 54648042 |
| Molecular Formula | C22H25NO8S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[(4-methoxyphenyl)sulfonylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H]2c3cc(NS(=O)(=O)c4ccc(OC)cc4)ccc3O[C@H]2[C@H](CO)O1 |
| InChI | InChI=1S/C22H25NO8S/c1-28-14-4-6-16(7-5-14)32(26,27)23-13-3-8-19-17(9-13)18-10-15(11-21(25)29-2)30-20(12-24)22(18)31-19/h3-9,15,18,20,22-24H,10-12H2,1-2H3/t15-,18-,20-,22+/m0/s1 |
| InChIKey | WYEDUFWRPDFXLO-DKWQAAHISA-N |
| XLogP | 2.05 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |