C33H31FN2O6S — CID 54648407
2-[(1R,3S,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenylphenyl)methyl]acetamide (PubChem CID 54648407) has the molecular formula C33H31FN2O6S and a molecular weight of 602.68 g/mol. Its IUPAC name is 2-[(1R,3S,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenylphenyl)methyl]acetamide.
| Compound Name | 2-[(1R,3S,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54648407 |
| Molecular Formula | C33H31FN2O6S |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 2-[(1R,3S,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-[(4-phenylphenyl)methyl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@@H]2c3cc(NS(=O)(=O)c4ccc(F)cc4)ccc3O[C@@H]2[C@@H](CO)O1)NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31FN2O6S/c34-24-10-13-27(14-11-24)43(39,40)36-25-12-15-30-28(16-25)29-17-26(41-31(20-37)33(29)42-30)18-32(38)35-19-21-6-8-23(9-7-21)22-4-2-1-3-5-22/h1-16,26,29,31,33,36-37H,17-20H2,(H,35,38)/t26-,29+,31+,33-/m0/s1 |
| InChIKey | GJUZXHBLRFQGNS-SWADQOEESA-N |
| XLogP | 4.99 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |