C27H32N2O6 — CID 54648594
N-[(1S,3R,4aR,9aS)-3-[2-(benzylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]oxane-4-carboxamide (PubChem CID 54648594) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[(1S,3R,4aR,9aS)-3-[2-(benzylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]oxane-4-carboxamide.
| Compound Name | N-[(1S,3R,4aR,9aS)-3-[2-(benzylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 54648594 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[(1S,3R,4aR,9aS)-3-[2-(benzylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]oxane-4-carboxamide |
| SMILES | O=C(C[C@H]1C[C@@H]2c3cc(NC(=O)C4CCOCC4)ccc3O[C@@H]2[C@H](CO)O1)NCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O6/c30-16-24-26-22(13-20(34-24)14-25(31)28-15-17-4-2-1-3-5-17)21-12-19(6-7-23(21)35-26)29-27(32)18-8-10-33-11-9-18/h1-7,12,18,20,22,24,26,30H,8-11,13-16H2,(H,28,31)(H,29,32)/t20-,22-,24+,26+/m1/s1 |
| InChIKey | GHQRDQSSFVRIKU-GUAAGHCTSA-N |
| XLogP | 2.75 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |