C27H33N3O5 — CID 54648866
2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-(phenylcarbamoylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-cyclohexylacetamide (PubChem CID 54648866) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-(phenylcarbamoylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-(phenylcarbamoylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 54648866 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-(phenylcarbamoylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-cyclohexylacetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2c3cc(NC(=O)Nc4ccccc4)ccc3O[C@H]2[C@H](CO)O1)NC1CCCCC1 |
| InChI | InChI=1S/C27H33N3O5/c31-16-24-26-22(14-20(34-24)15-25(32)28-17-7-3-1-4-8-17)21-13-19(11-12-23(21)35-26)30-27(33)29-18-9-5-2-6-10-18/h2,5-6,9-13,17,20,22,24,26,31H,1,3-4,7-8,14-16H2,(H,28,32)(H2,29,30,33)/t20-,22-,24-,26+/m0/s1 |
| InChIKey | AGXPDRNZBVDYJK-IFPZXYOKSA-N |
| XLogP | 4.16 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |