C23H30F3N3O5 — CID 54648939
2-[(1S,3S,4aS,9aR)-6-(cyclohexylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 54648939) has the molecular formula C23H30F3N3O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-[(1S,3S,4aS,9aR)-6-(cyclohexylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(1S,3S,4aS,9aR)-6-(cyclohexylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 54648939 |
| Molecular Formula | C23H30F3N3O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-[(1S,3S,4aS,9aR)-6-(cyclohexylcarbamoylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2c3cc(NC(=O)NC4CCCCC4)ccc3O[C@H]2[C@H](CO)O1)NCC(F)(F)F |
| InChI | InChI=1S/C23H30F3N3O5/c24-23(25,26)12-27-20(31)10-15-9-17-16-8-14(29-22(32)28-13-4-2-1-3-5-13)6-7-18(16)34-21(17)19(11-30)33-15/h6-8,13,15,17,19,21,30H,1-5,9-12H2,(H,27,31)(H2,28,29,32)/t15-,17-,19-,21+/m0/s1 |
| InChIKey | RYKLMQJESDOCGA-WRGRXTPVSA-N |
| XLogP | 3.20 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |