C27H30N2O7 — CID 54648959
N-[(1S,3S,4aR,9aS)-3-[2-(cyclopentylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 54648959) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[(1S,3S,4aR,9aS)-3-[2-(cyclopentylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(1S,3S,4aR,9aS)-3-[2-(cyclopentylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 54648959 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[(1S,3S,4aR,9aS)-3-[2-(cyclopentylamino)-2-oxoethyl]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(C[C@@H]1C[C@@H]2c3cc(NC(=O)c4ccc5c(c4)OCO5)ccc3O[C@@H]2[C@H](CO)O1)NC1CCCC1 |
| InChI | InChI=1S/C27H30N2O7/c30-13-24-26-20(11-18(35-24)12-25(31)28-16-3-1-2-4-16)19-10-17(6-8-21(19)36-26)29-27(32)15-5-7-22-23(9-15)34-14-33-22/h5-10,16,18,20,24,26,30H,1-4,11-14H2,(H,28,31)(H,29,32)/t18-,20+,24-,26-/m0/s1 |
| InChIKey | IXCVUUQJXDNEMP-DZVUWMEYSA-N |
| XLogP | 3.11 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |