C22H20N6O4S — CID 5464919
1-amino-3-[(E)-[4-(1,3-benzoxazol-2-yl)-1-(2-ethyl-6-methylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]thiourea (PubChem CID 5464919) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-amino-3-[(E)-[4-(1,3-benzoxazol-2-yl)-1-(2-ethyl-6-methylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]thiourea.
| Compound Name | 1-amino-3-[(E)-[4-(1,3-benzoxazol-2-yl)-1-(2-ethyl-6-methylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 5464919 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-amino-3-[(E)-[4-(1,3-benzoxazol-2-yl)-1-(2-ethyl-6-methylphenyl)-2,5,6-trioxopiperidin-3-ylidene]amino]thiourea |
| SMILES | CCc1cccc(C)c1N1C(=O)C(=O)C(c2nc3ccccc3o2)/C(=N\NC(=S)NN)C1=O |
| InChI | InChI=1S/C22H20N6O4S/c1-3-12-8-6-7-11(2)17(12)28-20(30)16(26-27-22(33)25-23)15(18(29)21(28)31)19-24-13-9-4-5-10-14(13)32-19/h4-10,15H,3,23H2,1-2H3,(H2,25,27,33)/b26-16+ |
| InChIKey | LABLVXYDAPCUIC-WGOQTCKBSA-N |
| XLogP | 1.62 |
| TPSA | 142.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|