C24H28N4O3 — CID 54649816
(4S,7S)-7-benzyl-4-[(4-methoxyphenyl)methyl]-9-oxa-1,6,12,13-tetrazabicyclo[9.2.1]tetradeca-11(14),12-dien-5-one (PubChem CID 54649816) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4S,7S)-7-benzyl-4-[(4-methoxyphenyl)methyl]-9-oxa-1,6,12,13-tetrazabicyclo[9.2.1]tetradeca-11(14),12-dien-5-one.
| Compound Name | (4S,7S)-7-benzyl-4-[(4-methoxyphenyl)methyl]-9-oxa-1,6,12,13-tetrazabicyclo[9.2.1]tetradeca-11(14),12-dien-5-one |
|---|---|
| PubChem CID | 54649816 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (4S,7S)-7-benzyl-4-[(4-methoxyphenyl)methyl]-9-oxa-1,6,12,13-tetrazabicyclo[9.2.1]tetradeca-11(14),12-dien-5-one |
| SMILES | COc1ccc(C[C@H]2CCn3cc(nn3)COC[C@H](Cc3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-30-23-9-7-19(8-10-23)13-20-11-12-28-15-22(26-27-28)17-31-16-21(25-24(20)29)14-18-5-3-2-4-6-18/h2-10,15,20-21H,11-14,16-17H2,1H3,(H,25,29)/t20-,21+/m1/s1 |
| InChIKey | DGLSYQHHAPLUOV-RTWAWAEBSA-N |
| XLogP | 2.79 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |