C23H22FN3O2 — CID 54650719
(2S,3S,4S)-2-cyano-3-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-4-(hydroxymethyl)-N-propylazetidine-1-carboxamide (PubChem CID 54650719) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S,3S,4S)-2-cyano-3-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-4-(hydroxymethyl)-N-propylazetidine-1-carboxamide.
| Compound Name | (2S,3S,4S)-2-cyano-3-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-4-(hydroxymethyl)-N-propylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 54650719 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S,3S,4S)-2-cyano-3-[4-[2-(4-fluorophenyl)ethynyl]phenyl]-4-(hydroxymethyl)-N-propylazetidine-1-carboxamide |
| SMILES | CCCNC(=O)N1[C@H](C#N)[C@H](c2ccc(C#Cc3ccc(F)cc3)cc2)[C@H]1CO |
| InChI | InChI=1S/C23H22FN3O2/c1-2-13-26-23(29)27-20(14-25)22(21(27)15-28)18-9-5-16(6-10-18)3-4-17-7-11-19(24)12-8-17/h5-12,20-22,28H,2,13,15H2,1H3,(H,26,29)/t20-,21-,22+/m1/s1 |
| InChIKey | LBWGLLZEKHPZRA-VSKRKVRLSA-N |
| XLogP | 3.00 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|