C22H27N3O2 — CID 54651164
(2S,3R,4R)-2-cyano-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-N-propan-2-ylazetidine-1-carboxamide (PubChem CID 54651164) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (2S,3R,4R)-2-cyano-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-N-propan-2-ylazetidine-1-carboxamide.
| Compound Name | (2S,3R,4R)-2-cyano-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-N-propan-2-ylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 54651164 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2S,3R,4R)-2-cyano-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-N-propan-2-ylazetidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1[C@H](C#N)[C@@H](c2ccc(C#CC3CCCC3)cc2)[C@@H]1CO |
| InChI | InChI=1S/C22H27N3O2/c1-15(2)24-22(27)25-19(13-23)21(20(25)14-26)18-11-9-17(10-12-18)8-7-16-5-3-4-6-16/h9-12,15-16,19-21,26H,3-6,14H2,1-2H3,(H,24,27)/t19-,20+,21-/m1/s1 |
| InChIKey | MPWYWDMMWJBPIH-QHAWAJNXSA-N |
| XLogP | 3.00 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|